C19H22N2O7S2 — CID 19678046
dimethyl 3-methyl-5-[(3,4,5-trimethoxyphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate (PubChem CID 19678046) has the molecular formula C19H22N2O7S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is dimethyl 3-methyl-5-[(3,4,5-trimethoxyphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 3-methyl-5-[(3,4,5-trimethoxyphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19678046 |
| Molecular Formula | C19H22N2O7S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | dimethyl 3-methyl-5-[(3,4,5-trimethoxyphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=S)Nc2cc(OC)c(OC)c(OC)c2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C19H22N2O7S2/c1-9-13(17(22)27-5)16(30-15(9)18(23)28-6)21-19(29)20-10-7-11(24-2)14(26-4)12(8-10)25-3/h7-8H,1-6H3,(H2,20,21,29) |
| InChIKey | MFBNLVFUSKFATO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|