C20H32N2O4S2 — CID 19651259
dimethyl 5-(decylcarbamothioylamino)-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19651259) has the molecular formula C20H32N2O4S2 and a molecular weight of 428.62 g/mol. Its IUPAC name is dimethyl 5-(decylcarbamothioylamino)-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-(decylcarbamothioylamino)-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19651259 |
| Molecular Formula | C20H32N2O4S2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | dimethyl 5-(decylcarbamothioylamino)-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCCCCCCCCCNC(=S)Nc1sc(C(=O)OC)c(C)c1C(=O)OC |
| InChI | InChI=1S/C20H32N2O4S2/c1-5-6-7-8-9-10-11-12-13-21-20(27)22-17-15(18(23)25-3)14(2)16(28-17)19(24)26-4/h5-13H2,1-4H3,(H2,21,22,27) |
| InChIKey | RWNQEKAYFHJLTC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|