C17H25N3O4S2 — CID 17381831
dimethyl 5-[(1-ethylpiperidin-4-yl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 17381831) has the molecular formula C17H25N3O4S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is dimethyl 5-[(1-ethylpiperidin-4-yl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[(1-ethylpiperidin-4-yl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 17381831 |
| Molecular Formula | C17H25N3O4S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | dimethyl 5-[(1-ethylpiperidin-4-yl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCN1CCC(NC(=S)Nc2sc(C(=O)OC)c(C)c2C(=O)OC)CC1 |
| InChI | InChI=1S/C17H25N3O4S2/c1-5-20-8-6-11(7-9-20)18-17(25)19-14-12(15(21)23-3)10(2)13(26-14)16(22)24-4/h11H,5-9H2,1-4H3,(H2,18,19,25) |
| InChIKey | FLWJVXIMHCJFJN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|