C16H20N2O5S3 — CID 7605872
dimethyl 3-methyl-5-[[2-(pyrrolidine-1-carbothioylsulfanyl)acetyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 7605872) has the molecular formula C16H20N2O5S3 and a molecular weight of 416.55 g/mol. Its IUPAC name is dimethyl 3-methyl-5-[[2-(pyrrolidine-1-carbothioylsulfanyl)acetyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 3-methyl-5-[[2-(pyrrolidine-1-carbothioylsulfanyl)acetyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7605872 |
| Molecular Formula | C16H20N2O5S3 |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | dimethyl 3-methyl-5-[[2-(pyrrolidine-1-carbothioylsulfanyl)acetyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=O)CSC(=S)N2CCCC2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C16H20N2O5S3/c1-9-11(14(20)22-2)13(26-12(9)15(21)23-3)17-10(19)8-25-16(24)18-6-4-5-7-18/h4-8H2,1-3H3,(H,17,19) |
| InChIKey | YUMXTMUUFTULBY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|