C17H24N2O4S — CID 17062357
ethyl 2-(butanoylamino)-4-methyl-5-(pyrrolidine-1-carbonyl)thiophene-3-carboxylate (PubChem CID 17062357) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is ethyl 2-(butanoylamino)-4-methyl-5-(pyrrolidine-1-carbonyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-(butanoylamino)-4-methyl-5-(pyrrolidine-1-carbonyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17062357 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | ethyl 2-(butanoylamino)-4-methyl-5-(pyrrolidine-1-carbonyl)thiophene-3-carboxylate |
| SMILES | CCCC(=O)Nc1sc(C(=O)N2CCCC2)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C17H24N2O4S/c1-4-8-12(20)18-15-13(17(22)23-5-2)11(3)14(24-15)16(21)19-9-6-7-10-19/h4-10H2,1-3H3,(H,18,20) |
| InChIKey | XZMUDXDRCIENMY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |