C17H25N3O4S2 — CID 19653825
diethyl 3-methyl-5-[(4-methylpiperazine-1-carbothioyl)amino]thiophene-2,4-dicarboxylate (PubChem CID 19653825) has the molecular formula C17H25N3O4S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is diethyl 3-methyl-5-[(4-methylpiperazine-1-carbothioyl)amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[(4-methylpiperazine-1-carbothioyl)amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19653825 |
| Molecular Formula | C17H25N3O4S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | diethyl 3-methyl-5-[(4-methylpiperazine-1-carbothioyl)amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)N2CCN(C)CC2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C17H25N3O4S2/c1-5-23-15(21)12-11(3)13(16(22)24-6-2)26-14(12)18-17(25)20-9-7-19(4)8-10-20/h5-10H2,1-4H3,(H,18,25) |
| InChIKey | PKMWIKLDGKSQKW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|