C18H14F5NO5S — CID 2171781
diethyl 3-methyl-5-[(2,3,4,5,6-pentafluorobenzoyl)amino]thiophene-2,4-dicarboxylate (PubChem CID 2171781) has the molecular formula C18H14F5NO5S and a molecular weight of 451.37 g/mol. Its IUPAC name is diethyl 3-methyl-5-[(2,3,4,5,6-pentafluorobenzoyl)amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[(2,3,4,5,6-pentafluorobenzoyl)amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2171781 |
| Molecular Formula | C18H14F5NO5S |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | diethyl 3-methyl-5-[(2,3,4,5,6-pentafluorobenzoyl)amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2c(F)c(F)c(F)c(F)c2F)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C18H14F5NO5S/c1-4-28-17(26)7-6(3)14(18(27)29-5-2)30-16(7)24-15(25)8-9(19)11(21)13(23)12(22)10(8)20/h4-5H2,1-3H3,(H,24,25) |
| InChIKey | LQAWOYAJGSSVOD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|