C16H10F5NO5S — CID 3332536
dimethyl 3-methyl-5-[(2,3,4,5,6-pentafluorobenzoyl)amino]thiophene-2,4-dicarboxylate (PubChem CID 3332536) has the molecular formula C16H10F5NO5S and a molecular weight of 423.32 g/mol. Its IUPAC name is dimethyl 3-methyl-5-[(2,3,4,5,6-pentafluorobenzoyl)amino]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 3-methyl-5-[(2,3,4,5,6-pentafluorobenzoyl)amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3332536 |
| Molecular Formula | C16H10F5NO5S |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | dimethyl 3-methyl-5-[(2,3,4,5,6-pentafluorobenzoyl)amino]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=O)c2c(F)c(F)c(F)c(F)c2F)c(C(=O)OC)c1C |
| InChI | InChI=1S/C16H10F5NO5S/c1-4-5(15(24)26-2)14(28-12(4)16(25)27-3)22-13(23)6-7(17)9(19)11(21)10(20)8(6)18/h1-3H3,(H,22,23) |
| InChIKey | VVMGGHXRYYXSEY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|