C16H10F13NO5S — CID 4121907
dimethyl 3-methyl-5-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)thiophene-2,4-dicarboxylate (PubChem CID 4121907) has the molecular formula C16H10F13NO5S and a molecular weight of 575.30 g/mol. Its IUPAC name is dimethyl 3-methyl-5-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 3-methyl-5-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4121907 |
| Molecular Formula | C16H10F13NO5S |
| Molecular Weight | 575.30 g/mol |
| Exact Mass | 575.01 |
| IUPAC Name | dimethyl 3-methyl-5-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(C(=O)OC)c1C |
| InChI | InChI=1S/C16H10F13NO5S/c1-4-5(8(31)34-2)7(36-6(4)9(32)35-3)30-10(33)11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h1-3H3,(H,30,33) |
| InChIKey | KDOMWIADXIUAKP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.30 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|