C22H20F8N2O6S2 — CID 4155191
methyl 4,5-dimethyl-2-[[2,2,3,3,4,4,5,5-octafluoro-6-[(3-methoxycarbonyl-4,5-dimethylthiophen-2-yl)amino]-6-oxohexanoyl]amino]thiophene-3-carboxylate (PubChem CID 4155191) has the molecular formula C22H20F8N2O6S2 and a molecular weight of 624.53 g/mol. Its IUPAC name is methyl 4,5-dimethyl-2-[[2,2,3,3,4,4,5,5-octafluoro-6-[(3-methoxycarbonyl-4,5-dimethylthiophen-2-yl)amino]-6-oxohexanoyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4,5-dimethyl-2-[[2,2,3,3,4,4,5,5-octafluoro-6-[(3-methoxycarbonyl-4,5-dimethylthiophen-2-yl)amino]-6-oxohexanoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4155191 |
| Molecular Formula | C22H20F8N2O6S2 |
| Molecular Weight | 624.53 g/mol |
| Exact Mass | 624.06 |
| IUPAC Name | methyl 4,5-dimethyl-2-[[2,2,3,3,4,4,5,5-octafluoro-6-[(3-methoxycarbonyl-4,5-dimethylthiophen-2-yl)amino]-6-oxohexanoyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)Nc2sc(C)c(C)c2C(=O)OC)sc(C)c1C |
| InChI | InChI=1S/C22H20F8N2O6S2/c1-7-9(3)39-13(11(7)15(33)37-5)31-17(35)19(23,24)21(27,28)22(29,30)20(25,26)18(36)32-14-12(16(34)38-6)8(2)10(4)40-14/h1-6H3,(H,31,35)(H,32,36) |
| InChIKey | OCRRUWMQCCOQQZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|