C15H15F7N2O4S — CID 4206476
ethyl 5-(dimethylcarbamoyl)-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylthiophene-3-carboxylate (PubChem CID 4206476) has the molecular formula C15H15F7N2O4S and a molecular weight of 452.35 g/mol. Its IUPAC name is ethyl 5-(dimethylcarbamoyl)-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-(dimethylcarbamoyl)-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4206476 |
| Molecular Formula | C15H15F7N2O4S |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | ethyl 5-(dimethylcarbamoyl)-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C15H15F7N2O4S/c1-5-28-11(26)7-6(2)8(10(25)24(3)4)29-9(7)23-12(27)13(16,17)14(18,19)15(20,21)22/h5H2,1-4H3,(H,23,27) |
| InChIKey | FWHBXRQSISWCDF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|