C11H11Cl3N2O4S — CID 3552288
ethyl 5-carbamoyl-4-methyl-2-[(2,2,2-trichloroacetyl)amino]thiophene-3-carboxylate (PubChem CID 3552288) has the molecular formula C11H11Cl3N2O4S and a molecular weight of 373.65 g/mol. Its IUPAC name is ethyl 5-carbamoyl-4-methyl-2-[(2,2,2-trichloroacetyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-carbamoyl-4-methyl-2-[(2,2,2-trichloroacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3552288 |
| Molecular Formula | C11H11Cl3N2O4S |
| Molecular Weight | 373.65 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | ethyl 5-carbamoyl-4-methyl-2-[(2,2,2-trichloroacetyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(Cl)(Cl)Cl)sc(C(N)=O)c1C |
| InChI | InChI=1S/C11H11Cl3N2O4S/c1-3-20-9(18)5-4(2)6(7(15)17)21-8(5)16-10(19)11(12,13)14/h3H2,1-2H3,(H2,15,17)(H,16,19) |
| InChIKey | ZQUJLNPOLFXSFR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.65 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|