C16H15BrN2O4S — CID 1221975
ethyl 2-[(4-bromobenzoyl)amino]-5-carbamoyl-4-methylthiophene-3-carboxylate (PubChem CID 1221975) has the molecular formula C16H15BrN2O4S and a molecular weight of 411.28 g/mol. Its IUPAC name is ethyl 2-[(4-bromobenzoyl)amino]-5-carbamoyl-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(4-bromobenzoyl)amino]-5-carbamoyl-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 1221975 |
| Molecular Formula | C16H15BrN2O4S |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | ethyl 2-[(4-bromobenzoyl)amino]-5-carbamoyl-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(Br)cc2)sc(C(N)=O)c1C |
| InChI | InChI=1S/C16H15BrN2O4S/c1-3-23-16(22)11-8(2)12(13(18)20)24-15(11)19-14(21)9-4-6-10(17)7-5-9/h4-7H,3H2,1-2H3,(H2,18,20)(H,19,21) |
| InChIKey | JNEIJDRPJLUWDM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |