C15H13ClN2O4S — CID 1225568
methyl 5-carbamoyl-2-[(4-chlorobenzoyl)amino]-4-methylthiophene-3-carboxylate (PubChem CID 1225568) has the molecular formula C15H13ClN2O4S and a molecular weight of 352.80 g/mol. Its IUPAC name is methyl 5-carbamoyl-2-[(4-chlorobenzoyl)amino]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-carbamoyl-2-[(4-chlorobenzoyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 1225568 |
| Molecular Formula | C15H13ClN2O4S |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | methyl 5-carbamoyl-2-[(4-chlorobenzoyl)amino]-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2ccc(Cl)cc2)sc(C(N)=O)c1C |
| InChI | InChI=1S/C15H13ClN2O4S/c1-7-10(15(21)22-2)14(23-11(7)12(17)19)18-13(20)8-3-5-9(16)6-4-8/h3-6H,1-2H3,(H2,17,19)(H,18,20) |
| InChIKey | HDQJUKAHIXRJHR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |