C21H17NO4S — CID 982691
methyl 2-benzamido-5-benzoyl-4-methylthiophene-3-carboxylate (PubChem CID 982691) has the molecular formula C21H17NO4S and a molecular weight of 379.44 g/mol. Its IUPAC name is methyl 2-benzamido-5-benzoyl-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-benzamido-5-benzoyl-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 982691 |
| Molecular Formula | C21H17NO4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | methyl 2-benzamido-5-benzoyl-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2ccccc2)sc(C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C21H17NO4S/c1-13-16(21(25)26-2)20(22-19(24)15-11-7-4-8-12-15)27-18(13)17(23)14-9-5-3-6-10-14/h3-12H,1-2H3,(H,22,24) |
| InChIKey | RYLQZQIWNKAVGJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |