C22H20N2O5S — CID 1071066
methyl 2-benzamido-5-[(2-methoxyphenyl)carbamoyl]-4-methylthiophene-3-carboxylate (PubChem CID 1071066) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is methyl 2-benzamido-5-[(2-methoxyphenyl)carbamoyl]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-benzamido-5-[(2-methoxyphenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 1071066 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | methyl 2-benzamido-5-[(2-methoxyphenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2ccccc2)sc(C(=O)Nc2ccccc2OC)c1C |
| InChI | InChI=1S/C22H20N2O5S/c1-13-17(22(27)29-3)21(24-19(25)14-9-5-4-6-10-14)30-18(13)20(26)23-15-11-7-8-12-16(15)28-2/h4-12H,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | ZOZDYEVIOUKACE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |