C12H16N2O4S2 — CID 2771018
diethyl 5-(carbamothioylamino)-3-methylthiophene-2,4-dicarboxylate (PubChem CID 2771018) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is diethyl 5-(carbamothioylamino)-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-(carbamothioylamino)-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2771018 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | diethyl 5-(carbamothioylamino)-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(N)=S)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C12H16N2O4S2/c1-4-17-10(15)7-6(3)8(11(16)18-5-2)20-9(7)14-12(13)19/h4-5H2,1-3H3,(H3,13,14,19) |
| InChIKey | VILYTVWYHKMBQO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|