C20H32N2O4S2 — CID 19652292
diethyl 3-methyl-5-(2,4,4-trimethylpentan-2-ylcarbamothioylamino)thiophene-2,4-dicarboxylate (PubChem CID 19652292) has the molecular formula C20H32N2O4S2 and a molecular weight of 428.62 g/mol. Its IUPAC name is diethyl 3-methyl-5-(2,4,4-trimethylpentan-2-ylcarbamothioylamino)thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-(2,4,4-trimethylpentan-2-ylcarbamothioylamino)thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19652292 |
| Molecular Formula | C20H32N2O4S2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | diethyl 3-methyl-5-(2,4,4-trimethylpentan-2-ylcarbamothioylamino)thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NC(C)(C)CC(C)(C)C)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C20H32N2O4S2/c1-9-25-16(23)13-12(3)14(17(24)26-10-2)28-15(13)21-18(27)22-20(7,8)11-19(4,5)6/h9-11H2,1-8H3,(H2,21,22,27) |
| InChIKey | RMRMEQXPTKWQLR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|