C14H19NO6S2 — CID 11537799
diethyl 5-(2-hydroxyethoxycarbothioylamino)-3-methylthiophene-2,4-dicarboxylate (PubChem CID 11537799) has the molecular formula C14H19NO6S2 and a molecular weight of 361.44 g/mol. Its IUPAC name is diethyl 5-(2-hydroxyethoxycarbothioylamino)-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-(2-hydroxyethoxycarbothioylamino)-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 11537799 |
| Molecular Formula | C14H19NO6S2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | diethyl 5-(2-hydroxyethoxycarbothioylamino)-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)OCCO)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C14H19NO6S2/c1-4-19-12(17)9-8(3)10(13(18)20-5-2)23-11(9)15-14(22)21-7-6-16/h16H,4-7H2,1-3H3,(H,15,22) |
| InChIKey | VMBJWERZGCNZLG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|