C17H25N3O6S3 — CID 2211477
diethyl 3-methyl-5-[(4-methylsulfonylpiperazine-1-carbothioyl)amino]thiophene-2,4-dicarboxylate (PubChem CID 2211477) has the molecular formula C17H25N3O6S3 and a molecular weight of 463.60 g/mol. Its IUPAC name is diethyl 3-methyl-5-[(4-methylsulfonylpiperazine-1-carbothioyl)amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[(4-methylsulfonylpiperazine-1-carbothioyl)amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2211477 |
| Molecular Formula | C17H25N3O6S3 |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | diethyl 3-methyl-5-[(4-methylsulfonylpiperazine-1-carbothioyl)amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)N2CCN(S(C)(=O)=O)CC2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C17H25N3O6S3/c1-5-25-15(21)12-11(3)13(16(22)26-6-2)28-14(12)18-17(27)19-7-9-20(10-8-19)29(4,23)24/h5-10H2,1-4H3,(H,18,27) |
| InChIKey | CJHDCCYXMFPWOJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|