C23H29N3O7S3 — CID 19711698
diethyl 5-[[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbothioyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19711698) has the molecular formula C23H29N3O7S3 and a molecular weight of 555.70 g/mol. Its IUPAC name is diethyl 5-[[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbothioyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbothioyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19711698 |
| Molecular Formula | C23H29N3O7S3 |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | diethyl 5-[[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbothioyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)N2CCN(S(=O)(=O)c3ccc(OC)cc3)CC2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C23H29N3O7S3/c1-5-32-21(27)18-15(3)19(22(28)33-6-2)35-20(18)24-23(34)25-11-13-26(14-12-25)36(29,30)17-9-7-16(31-4)8-10-17/h7-10H,5-6,11-14H2,1-4H3,(H,24,34) |
| InChIKey | YBSIFJXYQJWKBL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|