C23H31N3O4S3 — CID 17265838
methyl 2-[[4-(4-butylphenyl)sulfonylpiperazine-1-carbothioyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 17265838) has the molecular formula C23H31N3O4S3 and a molecular weight of 509.72 g/mol. Its IUPAC name is methyl 2-[[4-(4-butylphenyl)sulfonylpiperazine-1-carbothioyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[4-(4-butylphenyl)sulfonylpiperazine-1-carbothioyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17265838 |
| Molecular Formula | C23H31N3O4S3 |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | methyl 2-[[4-(4-butylphenyl)sulfonylpiperazine-1-carbothioyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCCCc1ccc(S(=O)(=O)N2CCN(C(=S)Nc3sc(C)c(C)c3C(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C23H31N3O4S3/c1-5-6-7-18-8-10-19(11-9-18)33(28,29)26-14-12-25(13-15-26)23(31)24-21-20(22(27)30-4)16(2)17(3)32-21/h8-11H,5-7,12-15H2,1-4H3,(H,24,31) |
| InChIKey | IQPMBKAOCYIDOJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|