C20H25N3O2S2 — CID 19654878
methyl 2-[(4-ethylpiperazine-1-carbothioyl)amino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 19654878) has the molecular formula C20H25N3O2S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is methyl 2-[(4-ethylpiperazine-1-carbothioyl)amino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(4-ethylpiperazine-1-carbothioyl)amino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19654878 |
| Molecular Formula | C20H25N3O2S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | methyl 2-[(4-ethylpiperazine-1-carbothioyl)amino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | CCN1CCN(C(=S)Nc2sc(C)c(-c3ccccc3)c2C(=O)OC)CC1 |
| InChI | InChI=1S/C20H25N3O2S2/c1-4-22-10-12-23(13-11-22)20(26)21-18-17(19(24)25-3)16(14(2)27-18)15-8-6-5-7-9-15/h5-9H,4,10-13H2,1-3H3,(H,21,26) |
| InChIKey | RNHSKTNMDYTUKH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|