C23H22N2O2S2 — CID 27525847
methyl 5-methyl-2-[[(2R)-2-methyl-2,3-dihydroindole-1-carbothioyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 27525847) has the molecular formula C23H22N2O2S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is methyl 5-methyl-2-[[(2R)-2-methyl-2,3-dihydroindole-1-carbothioyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 5-methyl-2-[[(2R)-2-methyl-2,3-dihydroindole-1-carbothioyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 27525847 |
| Molecular Formula | C23H22N2O2S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | methyl 5-methyl-2-[[(2R)-2-methyl-2,3-dihydroindole-1-carbothioyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)N2c3ccccc3C[C@H]2C)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C23H22N2O2S2/c1-14-13-17-11-7-8-12-18(17)25(14)23(28)24-21-20(22(26)27-3)19(15(2)29-21)16-9-5-4-6-10-16/h4-12,14H,13H2,1-3H3,(H,24,28)/t14-/m1/s1 |
| InChIKey | FVPXMYUWBNVRED-CQSZACIVSA-N |
| XLogP | 5.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|