C25H27N3O3S2 — CID 19655244
methyl 2-[[4-(2-methoxyphenyl)piperazine-1-carbothioyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 19655244) has the molecular formula C25H27N3O3S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is methyl 2-[[4-(2-methoxyphenyl)piperazine-1-carbothioyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[4-(2-methoxyphenyl)piperazine-1-carbothioyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19655244 |
| Molecular Formula | C25H27N3O3S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | methyl 2-[[4-(2-methoxyphenyl)piperazine-1-carbothioyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)N2CCN(c3ccccc3OC)CC2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C25H27N3O3S2/c1-17-21(18-9-5-4-6-10-18)22(24(29)31-3)23(33-17)26-25(32)28-15-13-27(14-16-28)19-11-7-8-12-20(19)30-2/h4-12H,13-16H2,1-3H3,(H,26,32) |
| InChIKey | FTDCLCVYFLIVKI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|