C27H31N3O4S — CID 22199568
methyl 2-[[2-[4-(2-ethoxyphenyl)piperazin-1-yl]acetyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 22199568) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is methyl 2-[[2-[4-(2-ethoxyphenyl)piperazin-1-yl]acetyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[4-(2-ethoxyphenyl)piperazin-1-yl]acetyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 22199568 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | methyl 2-[[2-[4-(2-ethoxyphenyl)piperazin-1-yl]acetyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | CCOc1ccccc1N1CCN(CC(=O)Nc2sc(C)c(-c3ccccc3)c2C(=O)OC)CC1 |
| InChI | InChI=1S/C27H31N3O4S/c1-4-34-22-13-9-8-12-21(22)30-16-14-29(15-17-30)18-23(31)28-26-25(27(32)33-3)24(19(2)35-26)20-10-6-5-7-11-20/h5-13H,4,14-18H2,1-3H3,(H,28,31) |
| InChIKey | ABKHOXPJOWKFCD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|