C26H27Cl2N3O3S — CID 22194853
methyl 2-[[2-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]acetyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 22194853) has the molecular formula C26H27Cl2N3O3S and a molecular weight of 532.49 g/mol. Its IUPAC name is methyl 2-[[2-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]acetyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]acetyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 22194853 |
| Molecular Formula | C26H27Cl2N3O3S |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | methyl 2-[[2-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]acetyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CN2CCN(Cc3ccc(Cl)cc3Cl)CC2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C26H27Cl2N3O3S/c1-17-23(18-6-4-3-5-7-18)24(26(33)34-2)25(35-17)29-22(32)16-31-12-10-30(11-13-31)15-19-8-9-20(27)14-21(19)28/h3-9,14H,10-13,15-16H2,1-2H3,(H,29,32) |
| InChIKey | GTSCFEUXHHNVFG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|