C26H28ClN3O3S — CID 22194662
methyl 2-[[2-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]acetyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 22194662) has the molecular formula C26H28ClN3O3S and a molecular weight of 498.05 g/mol. Its IUPAC name is methyl 2-[[2-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]acetyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]acetyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 22194662 |
| Molecular Formula | C26H28ClN3O3S |
| Molecular Weight | 498.05 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | methyl 2-[[2-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]acetyl]amino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CN2CCN(Cc3ccccc3Cl)CC2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C26H28ClN3O3S/c1-18-23(19-8-4-3-5-9-19)24(26(32)33-2)25(34-18)28-22(31)17-30-14-12-29(13-15-30)16-20-10-6-7-11-21(20)27/h3-11H,12-17H2,1-2H3,(H,28,31) |
| InChIKey | ZTCCQXDRKWDOFH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.05 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|