C24H27N5O3S — CID 27158130
ethyl 5-methyl-4-phenyl-2-[[2-(4-pyrimidin-2-ylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 27158130) has the molecular formula C24H27N5O3S and a molecular weight of 465.58 g/mol. Its IUPAC name is ethyl 5-methyl-4-phenyl-2-[[2-(4-pyrimidin-2-ylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-4-phenyl-2-[[2-(4-pyrimidin-2-ylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 27158130 |
| Molecular Formula | C24H27N5O3S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | ethyl 5-methyl-4-phenyl-2-[[2-(4-pyrimidin-2-ylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CN2CCN(c3ncccn3)CC2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C24H27N5O3S/c1-3-32-23(31)21-20(18-8-5-4-6-9-18)17(2)33-22(21)27-19(30)16-28-12-14-29(15-13-28)24-25-10-7-11-26-24/h4-11H,3,12-16H2,1-2H3,(H,27,30) |
| InChIKey | HXCVMAFJEQMCDE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|