C18H23N5O2S2 — CID 10716271
ethyl 4,5-dimethyl-2-[(4-pyrimidin-2-ylpiperazine-1-carbothioyl)amino]thiophene-3-carboxylate (PubChem CID 10716271) has the molecular formula C18H23N5O2S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is ethyl 4,5-dimethyl-2-[(4-pyrimidin-2-ylpiperazine-1-carbothioyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4,5-dimethyl-2-[(4-pyrimidin-2-ylpiperazine-1-carbothioyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 10716271 |
| Molecular Formula | C18H23N5O2S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | ethyl 4,5-dimethyl-2-[(4-pyrimidin-2-ylpiperazine-1-carbothioyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)N2CCN(c3ncccn3)CC2)sc(C)c1C |
| InChI | InChI=1S/C18H23N5O2S2/c1-4-25-16(24)14-12(2)13(3)27-15(14)21-18(26)23-10-8-22(9-11-23)17-19-6-5-7-20-17/h5-7H,4,8-11H2,1-3H3,(H,21,26) |
| InChIKey | WYJSMZIVDSQXJL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|