C21H26N4O4S2 — CID 19655152
diethyl 3-methyl-5-[(4-pyridin-2-ylpiperazine-1-carbothioyl)amino]thiophene-2,4-dicarboxylate (PubChem CID 19655152) has the molecular formula C21H26N4O4S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is diethyl 3-methyl-5-[(4-pyridin-2-ylpiperazine-1-carbothioyl)amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[(4-pyridin-2-ylpiperazine-1-carbothioyl)amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19655152 |
| Molecular Formula | C21H26N4O4S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | diethyl 3-methyl-5-[(4-pyridin-2-ylpiperazine-1-carbothioyl)amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)N2CCN(c3ccccn3)CC2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C21H26N4O4S2/c1-4-28-19(26)16-14(3)17(20(27)29-5-2)31-18(16)23-21(30)25-12-10-24(11-13-25)15-8-6-7-9-22-15/h6-9H,4-5,10-13H2,1-3H3,(H,23,30) |
| InChIKey | VDYZIHYGVJGSAY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|