C19H22N2O4S2 — CID 19649307
diethyl 5-(benzylcarbamothioylamino)-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19649307) has the molecular formula C19H22N2O4S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is diethyl 5-(benzylcarbamothioylamino)-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-(benzylcarbamothioylamino)-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19649307 |
| Molecular Formula | C19H22N2O4S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | diethyl 5-(benzylcarbamothioylamino)-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NCc2ccccc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C19H22N2O4S2/c1-4-24-17(22)14-12(3)15(18(23)25-5-2)27-16(14)21-19(26)20-11-13-9-7-6-8-10-13/h6-10H,4-5,11H2,1-3H3,(H2,20,21,26) |
| InChIKey | OKXOMBQOAJMBOO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|