C24H24N2O4S3 — CID 19677708
diethyl 3-methyl-5-[(2-phenylsulfanylphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate (PubChem CID 19677708) has the molecular formula C24H24N2O4S3 and a molecular weight of 500.67 g/mol. Its IUPAC name is diethyl 3-methyl-5-[(2-phenylsulfanylphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[(2-phenylsulfanylphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19677708 |
| Molecular Formula | C24H24N2O4S3 |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | diethyl 3-methyl-5-[(2-phenylsulfanylphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)Nc2ccccc2Sc2ccccc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C24H24N2O4S3/c1-4-29-22(27)19-15(3)20(23(28)30-5-2)33-21(19)26-24(31)25-17-13-9-10-14-18(17)32-16-11-7-6-8-12-16/h6-14H,4-5H2,1-3H3,(H2,25,26,31) |
| InChIKey | QVAOOMOPQCVRGK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|