C24H24N2O2S3 — CID 19677701
ethyl 2-[(2-phenylsulfanylphenyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19677701) has the molecular formula C24H24N2O2S3 and a molecular weight of 468.67 g/mol. Its IUPAC name is ethyl 2-[(2-phenylsulfanylphenyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-phenylsulfanylphenyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19677701 |
| Molecular Formula | C24H24N2O2S3 |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | ethyl 2-[(2-phenylsulfanylphenyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)Nc2ccccc2Sc2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C24H24N2O2S3/c1-2-28-23(27)21-17-12-6-8-14-19(17)31-22(21)26-24(29)25-18-13-7-9-15-20(18)30-16-10-4-3-5-11-16/h3-5,7,9-11,13,15H,2,6,8,12,14H2,1H3,(H2,25,26,29) |
| InChIKey | GVKUMFSSKKAPEV-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|