C25H26N2O2S3 — CID 19677695
methyl 2-[(2-phenylsulfanylphenyl)carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19677695) has the molecular formula C25H26N2O2S3 and a molecular weight of 482.70 g/mol. Its IUPAC name is methyl 2-[(2-phenylsulfanylphenyl)carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-phenylsulfanylphenyl)carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19677695 |
| Molecular Formula | C25H26N2O2S3 |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | methyl 2-[(2-phenylsulfanylphenyl)carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2ccccc2Sc2ccccc2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C25H26N2O2S3/c1-29-24(28)22-18-13-7-2-3-8-15-20(18)32-23(22)27-25(30)26-19-14-9-10-16-21(19)31-17-11-5-4-6-12-17/h4-6,9-12,14,16H,2-3,7-8,13,15H2,1H3,(H2,26,27,30) |
| InChIKey | BXWPHBNPBXJKDP-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|