C17H18N2O2S2 — CID 8660198
methyl 2-[(2-methylphenyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 8660198) has the molecular formula C17H18N2O2S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is methyl 2-[(2-methylphenyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-methylphenyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 8660198 |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | methyl 2-[(2-methylphenyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2ccccc2C)sc2c1CCC2 |
| InChI | InChI=1S/C17H18N2O2S2/c1-10-6-3-4-8-12(10)18-17(22)19-15-14(16(20)21-2)11-7-5-9-13(11)23-15/h3-4,6,8H,5,7,9H2,1-2H3,(H2,18,19,22) |
| InChIKey | YVQYTBCDPZNDLP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|