C20H24N2O2S2 — CID 19649796
methyl 2-(1-phenylethylcarbamothioylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 19649796) has the molecular formula C20H24N2O2S2 and a molecular weight of 388.56 g/mol. Its IUPAC name is methyl 2-(1-phenylethylcarbamothioylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-(1-phenylethylcarbamothioylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19649796 |
| Molecular Formula | C20H24N2O2S2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | methyl 2-(1-phenylethylcarbamothioylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NC(C)c2ccccc2)sc2c1CCCCC2 |
| InChI | InChI=1S/C20H24N2O2S2/c1-13(14-9-5-3-6-10-14)21-20(25)22-18-17(19(23)24-2)15-11-7-4-8-12-16(15)26-18/h3,5-6,9-10,13H,4,7-8,11-12H2,1-2H3,(H2,21,22,25) |
| InChIKey | HPOLTGNRXNXUFD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|