C19H23N3O2S2 — CID 19686177
methyl 2-[(6-methyl-2-pyridinyl)carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19686177) has the molecular formula C19H23N3O2S2 and a molecular weight of 389.55 g/mol. Its IUPAC name is methyl 2-[(6-methyl-2-pyridinyl)carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(6-methyl-2-pyridinyl)carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19686177 |
| Molecular Formula | C19H23N3O2S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | methyl 2-[(6-methyl-2-pyridinyl)carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2cccc(C)n2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C19H23N3O2S2/c1-12-8-7-11-15(20-12)21-19(25)22-17-16(18(23)24-2)13-9-5-3-4-6-10-14(13)26-17/h7-8,11H,3-6,9-10H2,1-2H3,(H2,20,21,22,25) |
| InChIKey | GMHCXVPPPZAVOC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|