C20H18N2O2S3 — CID 19677688
methyl 5-methyl-2-[(2-phenylsulfanylphenyl)carbamothioylamino]thiophene-3-carboxylate (PubChem CID 19677688) has the molecular formula C20H18N2O2S3 and a molecular weight of 414.58 g/mol. Its IUPAC name is methyl 5-methyl-2-[(2-phenylsulfanylphenyl)carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | methyl 5-methyl-2-[(2-phenylsulfanylphenyl)carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19677688 |
| Molecular Formula | C20H18N2O2S3 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | methyl 5-methyl-2-[(2-phenylsulfanylphenyl)carbamothioylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(C)sc1NC(=S)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C20H18N2O2S3/c1-13-12-15(19(23)24-2)18(26-13)22-20(25)21-16-10-6-7-11-17(16)27-14-8-4-3-5-9-14/h3-12H,1-2H3,(H2,21,22,25) |
| InChIKey | BHWYYNMYRXAENK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|