C15H15FN2O2S2 — CID 19687331
methyl 2-[(5-fluoro-2-methylphenyl)carbamothioylamino]-5-methylthiophene-3-carboxylate (PubChem CID 19687331) has the molecular formula C15H15FN2O2S2 and a molecular weight of 338.43 g/mol. Its IUPAC name is methyl 2-[(5-fluoro-2-methylphenyl)carbamothioylamino]-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(5-fluoro-2-methylphenyl)carbamothioylamino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19687331 |
| Molecular Formula | C15H15FN2O2S2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | methyl 2-[(5-fluoro-2-methylphenyl)carbamothioylamino]-5-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(C)sc1NC(=S)Nc1cc(F)ccc1C |
| InChI | InChI=1S/C15H15FN2O2S2/c1-8-4-5-10(16)7-12(8)17-15(21)18-13-11(14(19)20-3)6-9(2)22-13/h4-7H,1-3H3,(H2,17,18,21) |
| InChIKey | MXQSMTDCGZTULQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|