C27H24N2O2S3 — CID 19677704
ethyl 5-methyl-4-phenyl-2-[(2-phenylsulfanylphenyl)carbamothioylamino]thiophene-3-carboxylate (PubChem CID 19677704) has the molecular formula C27H24N2O2S3 and a molecular weight of 504.70 g/mol. Its IUPAC name is ethyl 5-methyl-4-phenyl-2-[(2-phenylsulfanylphenyl)carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-4-phenyl-2-[(2-phenylsulfanylphenyl)carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19677704 |
| Molecular Formula | C27H24N2O2S3 |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | ethyl 5-methyl-4-phenyl-2-[(2-phenylsulfanylphenyl)carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)Nc2ccccc2Sc2ccccc2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C27H24N2O2S3/c1-3-31-26(30)24-23(19-12-6-4-7-13-19)18(2)33-25(24)29-27(32)28-21-16-10-11-17-22(21)34-20-14-8-5-9-15-20/h4-17H,3H2,1-2H3,(H2,28,29,32) |
| InChIKey | UVMKWWQRVAMOJA-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|