C21H20N2O4S3 — CID 2210109
ethyl 2-[(2-methoxycarbonylthiophen-3-yl)carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 2210109) has the molecular formula C21H20N2O4S3 and a molecular weight of 460.60 g/mol. Its IUPAC name is ethyl 2-[(2-methoxycarbonylthiophen-3-yl)carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-methoxycarbonylthiophen-3-yl)carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2210109 |
| Molecular Formula | C21H20N2O4S3 |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | ethyl 2-[(2-methoxycarbonylthiophen-3-yl)carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)Nc2ccsc2C(=O)OC)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C21H20N2O4S3/c1-4-27-19(24)16-15(13-8-6-5-7-9-13)12(2)30-18(16)23-21(28)22-14-10-11-29-17(14)20(25)26-3/h5-11H,4H2,1-3H3,(H2,22,23,28) |
| InChIKey | CMHNNVCTDRVOQU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|