C27H22N2O3S2 — CID 19648865
methyl 2-[(2-benzoylphenyl)carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 19648865) has the molecular formula C27H22N2O3S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is methyl 2-[(2-benzoylphenyl)carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-benzoylphenyl)carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19648865 |
| Molecular Formula | C27H22N2O3S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | methyl 2-[(2-benzoylphenyl)carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2ccccc2C(=O)c2ccccc2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C27H22N2O3S2/c1-17-22(18-11-5-3-6-12-18)23(26(31)32-2)25(34-17)29-27(33)28-21-16-10-9-15-20(21)24(30)19-13-7-4-8-14-19/h3-16H,1-2H3,(H2,28,29,33) |
| InChIKey | IPKZMIOOTUNPEA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|