C19H17N3O2S2 — CID 19655567
methyl 5-methyl-4-phenyl-2-(pyridin-3-ylcarbamothioylamino)thiophene-3-carboxylate (PubChem CID 19655567) has the molecular formula C19H17N3O2S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is methyl 5-methyl-4-phenyl-2-(pyridin-3-ylcarbamothioylamino)thiophene-3-carboxylate.
| Compound Name | methyl 5-methyl-4-phenyl-2-(pyridin-3-ylcarbamothioylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19655567 |
| Molecular Formula | C19H17N3O2S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | methyl 5-methyl-4-phenyl-2-(pyridin-3-ylcarbamothioylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2cccnc2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C19H17N3O2S2/c1-12-15(13-7-4-3-5-8-13)16(18(23)24-2)17(26-12)22-19(25)21-14-9-6-10-20-11-14/h3-11H,1-2H3,(H2,21,22,25) |
| InChIKey | CPFWGXVWFIICHT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|