C21H16ClF3N2O2S2 — CID 19676680
methyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 19676680) has the molecular formula C21H16ClF3N2O2S2 and a molecular weight of 484.95 g/mol. Its IUPAC name is methyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19676680 |
| Molecular Formula | C21H16ClF3N2O2S2 |
| Molecular Weight | 484.95 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | methyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2ccc(Cl)c(C(F)(F)F)c2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C21H16ClF3N2O2S2/c1-11-16(12-6-4-3-5-7-12)17(19(28)29-2)18(31-11)27-20(30)26-13-8-9-15(22)14(10-13)21(23,24)25/h3-10H,1-2H3,(H2,26,27,30) |
| InChIKey | SMHGQRNDNHXYLW-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.95 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|