C15H8Cl2F6N2S — CID 4763346
1,3-bis[4-chloro-3-(trifluoromethyl)phenyl]thiourea (PubChem CID 4763346) has the molecular formula C15H8Cl2F6N2S and a molecular weight of 433.20 g/mol. Its IUPAC name is 1,3-bis[4-chloro-3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1,3-bis[4-chloro-3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 4763346 |
| Molecular Formula | C15H8Cl2F6N2S |
| Molecular Weight | 433.20 g/mol |
| Exact Mass | 431.97 |
| IUPAC Name | 1,3-bis[4-chloro-3-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1cc(NC(=S)Nc2ccc(Cl)c(C(F)(F)F)c2)ccc1Cl |
| InChI | InChI=1S/C15H8Cl2F6N2S/c16-11-3-1-7(5-9(11)14(18,19)20)24-13(26)25-8-2-4-12(17)10(6-8)15(21,22)23/h1-6H,(H2,24,25,26) |
| InChIKey | JNPJHQLVCDXQSG-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.20 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|