C12H14ClF3N2S — CID 100582048
1-tert-butyl-3-[4-chloro-3-(trifluoromethyl)phenyl]thiourea (PubChem CID 100582048) has the molecular formula C12H14ClF3N2S and a molecular weight of 310.77 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-chloro-3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-tert-butyl-3-[4-chloro-3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100582048 |
| Molecular Formula | C12H14ClF3N2S |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 1-tert-butyl-3-[4-chloro-3-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC(C)(C)NC(=S)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14ClF3N2S/c1-11(2,3)18-10(19)17-7-4-5-9(13)8(6-7)12(14,15)16/h4-6H,1-3H3,(H2,17,18,19) |
| InChIKey | ADKNOSHSUMUTLQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|