C9H9ClF3IN2S — CID 87582100
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylthiourea;hydroiodide (PubChem CID 87582100) has the molecular formula C9H9ClF3IN2S and a molecular weight of 396.60 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylthiourea;hydroiodide.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylthiourea;hydroiodide |
|---|---|
| PubChem CID | 87582100 |
| Molecular Formula | C9H9ClF3IN2S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 395.92 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylthiourea;hydroiodide |
| SMILES | CNC(=S)Nc1ccc(Cl)c(C(F)(F)F)c1.I |
| InChI | InChI=1S/C9H8ClF3N2S.HI/c1-14-8(16)15-5-2-3-7(10)6(4-5)9(11,12)13;/h2-4H,1H3,(H2,14,15,16);1H |
| InChIKey | SMWBLNKCRMWNNU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|