C22H18ClF3N2S — CID 100660449
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(S)-(4-methylphenyl)-phenylmethyl]thiourea (PubChem CID 100660449) has the molecular formula C22H18ClF3N2S and a molecular weight of 434.91 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(S)-(4-methylphenyl)-phenylmethyl]thiourea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(S)-(4-methylphenyl)-phenylmethyl]thiourea |
|---|---|
| PubChem CID | 100660449 |
| Molecular Formula | C22H18ClF3N2S |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(S)-(4-methylphenyl)-phenylmethyl]thiourea |
| SMILES | Cc1ccc([C@@H](NC(=S)Nc2ccc(Cl)c(C(F)(F)F)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18ClF3N2S/c1-14-7-9-16(10-8-14)20(15-5-3-2-4-6-15)28-21(29)27-17-11-12-19(23)18(13-17)22(24,25)26/h2-13,20H,1H3,(H2,27,28,29)/t20-/m0/s1 |
| InChIKey | JGLDTGCYSXZTRK-FQEVSTJZSA-N |
| XLogP | 6.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|