C21H18ClFN2S — CID 133216290
1-(3-chloro-4-fluorophenyl)-3-[(3-methylphenyl)-phenylmethyl]thiourea (PubChem CID 133216290) has the molecular formula C21H18ClFN2S and a molecular weight of 384.91 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[(3-methylphenyl)-phenylmethyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[(3-methylphenyl)-phenylmethyl]thiourea |
|---|---|
| PubChem CID | 133216290 |
| Molecular Formula | C21H18ClFN2S |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[(3-methylphenyl)-phenylmethyl]thiourea |
| SMILES | Cc1cccc(C(NC(=S)Nc2ccc(F)c(Cl)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C21H18ClFN2S/c1-14-6-5-9-16(12-14)20(15-7-3-2-4-8-15)25-21(26)24-17-10-11-19(23)18(22)13-17/h2-13,20H,1H3,(H2,24,25,26) |
| InChIKey | KXVUZDOSEDHKNV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|